Information card for entry 2218383
| Common name |
hydroxamic |
| Chemical name |
2-Hydroxy-3,3-dimethyl-7-nitro-3,4-dihydroisoquinolin-1(2H)-one |
| Formula |
C11 H12 N2 O4 |
| Calculated formula |
C11 H12 N2 O4 |
| SMILES |
C1(=O)c2cc(ccc2CC(C)(C)N1O)N(=O)=O |
| Title of publication |
2-Hydroxy-3,3-dimethyl-7-nitro-3,4-dihydroisoquinolin-1(2<i>H</i>)-one |
| Authors of publication |
Ben Salah, Hassen; Kammoun, Majed; Hamdi, Besma; Bohé, Luis; Damak, Mohamed |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
6 |
| Pages of publication |
o1050 |
| a |
5.8805 ± 0.0009 Å |
| b |
18.605 ± 0.004 Å |
| c |
10.1588 ± 0.0017 Å |
| α |
90° |
| β |
103.056 ± 0.012° |
| γ |
90° |
| Cell volume |
1082.7 ± 0.3 Å3 |
| Cell temperature |
296 K |
| Ambient diffraction temperature |
296 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0737 |
| Residual factor for significantly intense reflections |
0.0441 |
| Weighted residual factors for significantly intense reflections |
0.1072 |
| Weighted residual factors for all reflections included in the refinement |
0.1505 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.109 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218383.html