Information card for entry 2218441
| Chemical name |
2-Amino-4'-bromo-2',5-dioxo-4H,5H-pyrano[3,2-c]chromene-4-spiro-3'(2'H)- 1'H-indole-3-carbonitrile <i>N</i>,<i>N</i>-dimethylformamide solvate |
| Formula |
C23 H17 Br N4 O5 |
| Calculated formula |
C23 H17 Br N4 O5 |
| SMILES |
Brc1c2C3(C(=C(Oc4c3c(=O)oc3ccccc43)N)C#N)C(=O)Nc2ccc1.O=CN(C)C |
| Title of publication |
2-Amino-4'-bromo-2',5-dioxo-4<i>H</i>,5<i>H</i>-pyrano[3,2-<i>c</i>]chromene-4-spiro-3'(2'<i>H</i>)-1'<i>H</i>-indole-3-carbonitrile <i>N</i>,<i>N</i>-dimethylformamide solvate |
| Authors of publication |
Zhu, Song-Lei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
6 |
| Pages of publication |
o1162 |
| a |
17.004 ± 0.003 Å |
| b |
9.0452 ± 0.0015 Å |
| c |
14.415 ± 0.003 Å |
| α |
90° |
| β |
108.34 ± 0.003° |
| γ |
90° |
| Cell volume |
2104.5 ± 0.7 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0349 |
| Residual factor for significantly intense reflections |
0.0313 |
| Weighted residual factors for significantly intense reflections |
0.0656 |
| Weighted residual factors for all reflections included in the refinement |
0.067 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.089 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218441.html