Information card for entry 2218456
| Chemical name |
2-Bromomethyl-<i>N</i>-isopropyl-7,8-dimethoxy-1,2-dihydro-1,3- oxazolo[3,2-<i>a</i>]quinoline-4-carboxamide |
| Formula |
C18 H21 Br N2 O5 |
| Calculated formula |
C18 H21 Br N2 O5 |
| SMILES |
BrCC1Cn2c(O1)c(C(=O)NC(C)C)c(=O)c1c2cc(OC)c(c1)OC |
| Title of publication |
2-Bromomethyl-<i>N</i>-isopropyl-7,8-dimethoxy-1,2-dihydro-1,3-oxazolo[3,2-<i>a</i>]quinoline-4-carboxamide |
| Authors of publication |
Shishkina, Svetlana V.; Shishkin, Oleg V.; Ukrainets, Igor V.; Bereznyakova, Nataliya L.; Davidenko, Alexandra A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
6 |
| Pages of publication |
o1031 |
| a |
8.736 ± 0.002 Å |
| b |
9.968 ± 0.002 Å |
| c |
10.588 ± 0.003 Å |
| α |
86.9 ± 0.02° |
| β |
80.9 ± 0.02° |
| γ |
80.04 ± 0.02° |
| Cell volume |
896.3 ± 0.4 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.073 |
| Residual factor for significantly intense reflections |
0.066 |
| Weighted residual factors for significantly intense reflections |
0.163 |
| Weighted residual factors for all reflections included in the refinement |
0.171 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.048 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218456.html