Information card for entry 2218696
| Chemical name |
7,8,9,10-Tetrahydro-2-methylcyclohepta[<i>b</i>]indol-6(5<i>H</i>)-one |
| Formula |
C14 H15 N O |
| Calculated formula |
C14 H15 N O |
| SMILES |
C1(=O)CCCCc2c1[nH]c1ccc(cc21)C |
| Title of publication |
7,8,9,10-Tetrahydro-2-methylcyclohepta[<i>b</i>]indol-6(5<i>H</i>)-one |
| Authors of publication |
Sridharan, Makuteswaran; Prasad, Karnam J. Rajendra; Ngendahimana, Aimable; Zeller, Matthias |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
7 |
| Pages of publication |
o1207 |
| a |
11.461 ± 0.003 Å |
| b |
6.5062 ± 0.0019 Å |
| c |
14.459 ± 0.004 Å |
| α |
90° |
| β |
92.31 ± 0.004° |
| γ |
90° |
| Cell volume |
1077.3 ± 0.5 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1126 |
| Residual factor for significantly intense reflections |
0.0561 |
| Weighted residual factors for significantly intense reflections |
0.1122 |
| Weighted residual factors for all reflections included in the refinement |
0.1346 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.002 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218696.html