Information card for entry 2218781
| Chemical name |
<i>N</i>-[(<i>E</i>,<i>Z</i>)-1,3-Diphenylprop-2-enylidene]- <i>N</i>'-(1,3-dithiolan-2-ylidene)-hydrazine |
| Formula |
C18 H16 N2 S2 |
| Calculated formula |
C18 H16 N2 S2 |
| SMILES |
c1ccc(cc1)C(=N\N=C1SCCS1)/C=C/c1ccccc1 |
| Title of publication |
<i>N</i>-[(<i>E</i>,<i>Z</i>)-1,3-Diphenylprop-2-enylidene]-<i>N</i>'-(1,3-dithiolan-2-ylidene)hydrazine |
| Authors of publication |
Liu, Jian-Feng; Liu, Xiao-Lan; Liu, Yong-Hong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
7 |
| Pages of publication |
o1340 |
| a |
30.9008 ± 0.0009 Å |
| b |
5.7352 ± 0.0002 Å |
| c |
9.1499 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1621.57 ± 0.09 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0537 |
| Residual factor for significantly intense reflections |
0.0458 |
| Weighted residual factors for significantly intense reflections |
0.1128 |
| Weighted residual factors for all reflections included in the refinement |
0.1172 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.997 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218781.html