Information card for entry 2218783
| Chemical name |
N,N'-Bis[2-(methoxycarbonyl)ethyl]ethane-1,2-diammonium dichloride |
| Formula |
C10 H22 Cl2 N2 O4 |
| Calculated formula |
C10 H22 Cl2 N2 O4 |
| SMILES |
[NH2+](CC[NH2+]CCC(=O)OC)CCC(=O)OC.[Cl-].[Cl-] |
| Title of publication |
<i>N</i>,<i>N</i>'-Bis[2-(methoxycarbonyl)ethyl]ethane-1,2-diammonium dichloride |
| Authors of publication |
Kaluderović, Goran N.; Paethanom, Anchan; Wagner, Christoph; Sabo, Tibor J.; Schmidt, Harry |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
7 |
| Pages of publication |
o1232 |
| a |
8.903 ± 0.0008 Å |
| b |
10.3327 ± 0.001 Å |
| c |
8.3269 ± 0.001 Å |
| α |
90° |
| β |
101.763 ± 0.01° |
| γ |
90° |
| Cell volume |
749.92 ± 0.14 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0582 |
| Residual factor for significantly intense reflections |
0.0362 |
| Weighted residual factors for significantly intense reflections |
0.0768 |
| Weighted residual factors for all reflections included in the refinement |
0.0854 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.126 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218783.html