Information card for entry 2218922
| Chemical name |
<i>N</i>-(4-Bromophenylsulfonyl)-2,2,2-trimethylacetamide |
| Formula |
C11 H14 Br N O3 S |
| Calculated formula |
C11 H14 Br N O3 S |
| SMILES |
Brc1ccc(S(=O)(=O)NC(=O)C(C)(C)C)cc1 |
| Title of publication |
<i>N</i>-(4-Bromophenylsulfonyl)-2,2,2-trimethylacetamide |
| Authors of publication |
Gowda, B. Thimme; Foro, Sabine; Nirmala, P. G.; Sowmya, B. P.; Fuess, Hartmut |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
8 |
| Pages of publication |
o1389 |
| a |
6.066 ± 0.001 Å |
| b |
10.858 ± 0.001 Å |
| c |
11.092 ± 0.002 Å |
| α |
68.19 ± 0.01° |
| β |
78.66 ± 0.02° |
| γ |
88.1 ± 0.02° |
| Cell volume |
664.4 ± 0.19 Å3 |
| Cell temperature |
299 ± 2 K |
| Ambient diffraction temperature |
299 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0815 |
| Residual factor for significantly intense reflections |
0.0357 |
| Weighted residual factors for significantly intense reflections |
0.0826 |
| Weighted residual factors for all reflections included in the refinement |
0.101 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.966 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218922.html