Information card for entry 2218999
| Chemical name |
4,4'-[(1,3,4-Thiadiazole-2,5-diyl)bis(thiomethylene)]dibenzonitrile |
| Formula |
C18 H12 N4 S3 |
| Calculated formula |
C18 H12 N4 S3 |
| SMILES |
c1(nnc(s1)SCc1ccc(cc1)C#N)SCc1ccc(cc1)C#N |
| Title of publication |
4,4'-[(1,3,4-Thiadiazole-2,5-diyl)bis(thiomethylene)]dibenzonitrile |
| Authors of publication |
Wang, Wenxiang; Zhao, Hong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
8 |
| Pages of publication |
o1599 |
| a |
7.6974 ± 0.0015 Å |
| b |
8.4375 ± 0.0017 Å |
| c |
27.272 ± 0.006 Å |
| α |
90° |
| β |
92.53 ± 0.03° |
| γ |
90° |
| Cell volume |
1769.5 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0836 |
| Residual factor for significantly intense reflections |
0.0529 |
| Weighted residual factors for significantly intense reflections |
0.1043 |
| Weighted residual factors for all reflections included in the refinement |
0.1153 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.049 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2218999.html