Information card for entry 2219107
| Chemical name |
5',6-Dichloro-1',3',3'-trimethylspiro[2<i>H</i>-1-benzopyran-2,2'-indoline] |
| Formula |
C19 H17 Cl2 N O |
| Calculated formula |
C19 H17 Cl2 N O |
| SMILES |
Clc1cc2c(cc1)N(C)C1(C2(C)C)Oc2c(C=C1)cc(cc2)Cl |
| Title of publication |
5',6-Dichloro-1',3',3'-trimethylspiro[2<i>H</i>-1-benzopyran-2,2'-indoline] |
| Authors of publication |
Alhashimy, Nameer; Müller-Bunz, Helge; Schazmann, Benjamin; Diamond, Dermot |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
8 |
| Pages of publication |
o1430 - o1431 |
| a |
8.3105 ± 0.0007 Å |
| b |
18.2576 ± 0.0016 Å |
| c |
11.1921 ± 0.001 Å |
| α |
90° |
| β |
104.77 ± 0.002° |
| γ |
90° |
| Cell volume |
1642.1 ± 0.2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0513 |
| Residual factor for significantly intense reflections |
0.0464 |
| Weighted residual factors for significantly intense reflections |
0.1178 |
| Weighted residual factors for all reflections included in the refinement |
0.1223 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219107.html