Information card for entry 2219193
| Chemical name |
3,3'-Dibromo-1,1'-[ethylenedioxybis(nitrilomethylidyne)]dibenzene |
| Formula |
C16 H14 Br2 N2 O2 |
| Calculated formula |
C16 H14 Br2 N2 O2 |
| SMILES |
Brc1cccc(c1)/C=N/OCCO/N=C/c1cccc(c1)Br |
| Title of publication |
3,3'-Dibromo-1,1'-[ethylenedioxybis(nitrilomethylidyne)]dibenzene |
| Authors of publication |
Dong, Wen-Kui; Ding, Yu-Jie; Luo, Ya-Ling; Yan, Hai-Bo; Wang, Li |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
8 |
| Pages of publication |
o1636 |
| a |
4.5072 ± 0.0007 Å |
| b |
7.615 ± 0.002 Å |
| c |
23.18 ± 0.003 Å |
| α |
90° |
| β |
93.523 ± 0.002° |
| γ |
90° |
| Cell volume |
794.1 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0468 |
| Residual factor for significantly intense reflections |
0.0366 |
| Weighted residual factors for significantly intense reflections |
0.093 |
| Weighted residual factors for all reflections included in the refinement |
0.0973 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.041 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219193.html