Information card for entry 2219356
| Chemical name |
{2-[(2,5-Dimethylphenyl)iminomethyl]pyridine-κ^2^N,N'}diiodidozinc(II) |
| Formula |
C14 H14 I2 N2 Zn |
| Calculated formula |
C14 H14 I2 N2 Zn |
| SMILES |
[Zn]1(I)(I)[n]2ccccc2C=[N]1c1c(C)ccc(C)c1 |
| Title of publication |
{2-[(2,5-Dimethylphenyl)iminomethyl]pyridine-κ^2^<i>N</i>,<i>N</i>'}diiodidozinc(II) |
| Authors of publication |
Talei Bavil Olyai, Mohamad Reza; Dehghanpour, Saeed; Hoormehr, Bita; Gholami, Fahimeh; Khavasi, Hamid Reza |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
9 |
| Pages of publication |
m1191 |
| a |
11.467 ± 0.005 Å |
| b |
9.627 ± 0.004 Å |
| c |
15.868 ± 0.006 Å |
| α |
90° |
| β |
103.88 ± 0.03° |
| γ |
90° |
| Cell volume |
1700.6 ± 1.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.0713 |
| Weighted residual factors for all reflections included in the refinement |
0.2298 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.122 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219356.html