Information card for entry 2219363
| Chemical name |
<i>N</i>-{[2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]aminocarbonyl}- 2,6-difluorobenzamide |
| Formula |
C17 H8 Cl2 F8 N2 O3 |
| Calculated formula |
C17 H8 Cl2 F8 N2 O3 |
| SMILES |
Clc1cc(NC(=O)NC(=O)c2c(F)cccc2F)c(Cl)cc1OC(F)(F)C(F)C(F)(F)F |
| Title of publication |
<i>N</i>-{[2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]aminocarbonyl}-2,6-difluorobenzamide |
| Authors of publication |
Liu, Yin-hong; Li, Fang-shi; Li, Yi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
9 |
| Pages of publication |
o1756 |
| a |
9.23 ± 0.0018 Å |
| b |
16.404 ± 0.003 Å |
| c |
14.074 ± 0.003 Å |
| α |
90° |
| β |
108.77 ± 0.03° |
| γ |
90° |
| Cell volume |
2017.6 ± 0.8 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.152 |
| Residual factor for significantly intense reflections |
0.0856 |
| Weighted residual factors for significantly intense reflections |
0.2068 |
| Weighted residual factors for all reflections included in the refinement |
0.2475 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.086 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219363.html