Information card for entry 2219399
| Chemical name |
(E,E)-1,5-Di-2-thienylpenta-1,4-dien-3-one |
| Formula |
C13 H10 O S2 |
| Calculated formula |
C13 H10 O S2 |
| SMILES |
s1c(/C=C/C(=O)/C=C/c2sccc2)ccc1 |
| Title of publication |
(<i>E</i>,<i>E</i>)-1,5-Di-2-thienylpenta-1,4-dien-3-one |
| Authors of publication |
Murugavel, S.; Ganesh, G.; SubbiahPandi, A.; Murugan, Ramalingam; SrimanNarayanan, S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
9 |
| Pages of publication |
o1807 |
| a |
12.1141 ± 0.0004 Å |
| b |
7.4449 ± 0.0003 Å |
| c |
27.246 ± 0.001 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2457.27 ± 0.16 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.076 |
| Residual factor for significantly intense reflections |
0.0571 |
| Weighted residual factors for significantly intense reflections |
0.1805 |
| Weighted residual factors for all reflections included in the refinement |
0.2105 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.013 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219399.html