Information card for entry 2219484
| Chemical name |
2-(2-Chloropyrimidin-4-yl)-3,5,6,7,8,9-hexahydro-2<i>H</i>-1,2,4- triazolo[4,3-<i>a</i>]azepin-3-one |
| Formula |
C11 H12 Cl N5 O |
| Calculated formula |
C11 H12 Cl N5 O |
| SMILES |
Clc1nc(n2nc3n(CCCCC3)c2=O)ccn1 |
| Title of publication |
2-(2-Chloropyrimidin-4-yl)-3,5,6,7,8,9-hexahydro-2<i>H</i>-1,2,4-triazolo[4,3-<i>a</i>]azepin-3-one |
| Authors of publication |
Li, Gong-Chun; Wang, Li-Ye; Li, Zhao-Yang; Yang, Feng-Ling |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
10 |
| Pages of publication |
o1928 |
| a |
8.681 ± 0.0016 Å |
| b |
14.718 ± 0.003 Å |
| c |
9.4251 ± 0.0017 Å |
| α |
90° |
| β |
92.359 ± 0.003° |
| γ |
90° |
| Cell volume |
1203.2 ± 0.4 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1128 |
| Residual factor for significantly intense reflections |
0.0454 |
| Weighted residual factors for significantly intense reflections |
0.1024 |
| Weighted residual factors for all reflections included in the refinement |
0.1297 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.007 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219484.html