Information card for entry 2219554
| Chemical name |
Aqua(picolinato N-oxide-κ^2^O^1^,<i>O</i>^2^)(pyridine-2,6- dicarboxylato-κ^3^O,<i>N</i>,<i>O</i>')iron(III) monohydrate |
| Formula |
C13 H11 Fe N2 O9 |
| Calculated formula |
C13 H11 Fe N2 O9 |
| SMILES |
[Fe]123([n]4c(C(=O)O1)cccc4C(=O)O2)(OC(=O)c1n(cccc1)=[O]3)[OH2].O |
| Title of publication |
Aqua(picolinato <i>N</i>-oxide-κ^2^<i>O</i>^1^,<i>O</i>^2^)(pyridine-2,6-dicarboxylato-κ^3^<i>O</i>,<i>N</i>,<i>O</i>')iron(III) monohydrate |
| Authors of publication |
Han, Dongdong; Wang, Dong'e |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
10 |
| Pages of publication |
m1343 |
| a |
6.6023 ± 0.0013 Å |
| b |
7.7256 ± 0.0016 Å |
| c |
15.52 ± 0.003 Å |
| α |
102.585 ± 0.004° |
| β |
95.801 ± 0.004° |
| γ |
105.743 ± 0.004° |
| Cell volume |
732.7 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1061 |
| Residual factor for significantly intense reflections |
0.0602 |
| Weighted residual factors for significantly intense reflections |
0.0842 |
| Weighted residual factors for all reflections included in the refinement |
0.0959 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.85 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219554.html