Information card for entry 2219579
| Chemical name |
6,6'-Dihydroxy-2,2'-[(butane-1,4-diyldioxy)bis(nitrilomethylidyne)]diphenol |
| Formula |
C18 H20 N2 O6 |
| Calculated formula |
C18 H20 N2 O6 |
| SMILES |
Oc1c(cccc1O)/C=N/OCCCCO/N=C/c1cccc(c1O)O |
| Title of publication |
6,6'-Dihydroxy-2,2'-[(butane-1,4-diyldioxy)bis(nitrilomethylidyne)]diphenol |
| Authors of publication |
Dong, Wen-Kui; He, Xue-Ni; Sun, Yin-Xia; Xu, Li; Guan, Yong-Hong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
10 |
| Pages of publication |
o1917 |
| a |
27.484 ± 0.003 Å |
| b |
4.7106 ± 0.0007 Å |
| c |
14.0081 ± 0.0019 Å |
| α |
90° |
| β |
104.306 ± 0.002° |
| γ |
90° |
| Cell volume |
1757.3 ± 0.4 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0563 |
| Residual factor for significantly intense reflections |
0.0355 |
| Weighted residual factors for significantly intense reflections |
0.0872 |
| Weighted residual factors for all reflections included in the refinement |
0.1061 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.099 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219579.html