Information card for entry 2219703
| Common name |
2-(1-oxo-2-pyridylsulfanylmethyl)durene |
| Chemical name |
2-(2,3,5,6-Tetramethylbenzylsulfanyl)pyridine N-oxide |
| Formula |
C16 H19 N O S |
| Calculated formula |
C16 H19 N O S |
| SMILES |
c1(ccccn1=O)SCc1c(c(cc(c1C)C)C)C |
| Title of publication |
2-(2,3,5,6-Tetramethylbenzylsulfanyl)pyridine <i>N</i>-oxide |
| Authors of publication |
Ravindran Durai Nayagam, B.; Jebas, Samuel Robinson; Jebaraj Devadasan, J.; Schollmeyer, Dieter |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
10 |
| Pages of publication |
o1975 |
| a |
16.601 ± 0.006 Å |
| b |
9.1562 ± 0.0008 Å |
| c |
9.696 ± 0.004 Å |
| α |
90° |
| β |
106.098 ± 0.016° |
| γ |
90° |
| Cell volume |
1416 ± 0.8 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0572 |
| Residual factor for significantly intense reflections |
0.0499 |
| Weighted residual factors for significantly intense reflections |
0.1366 |
| Weighted residual factors for all reflections included in the refinement |
0.1443 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219703.html