Information card for entry 2219881
| Chemical name |
Trichlorido(5,5'-dimethyl-2,2'-bipyridine- κ^2^<i>N</i>,<i>N</i>')(methanol-κO)indium(III) |
| Formula |
C13 H16 Cl3 In N2 O |
| Calculated formula |
C13 H16 Cl3 In N2 O |
| SMILES |
[In]1([n]2c(c3[n]1cc(C)cc3)ccc(C)c2)(Cl)(Cl)(Cl)[OH]C |
| Title of publication |
Trichlorido(5,5'-dimethyl-2,2'-bipyridine-κ^2^<i>N</i>,<i>N</i>')(methanol-κ<i>O</i>)indium(III) |
| Authors of publication |
Kalateh, Khadijeh; Ahmadi, Roya; Ebadi, Amin; Amani, Vahid; Khavasi, Hamid Reza |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
11 |
| Pages of publication |
m1353 - m1354 |
| a |
10.908 ± 0.0006 Å |
| b |
11.2087 ± 0.0007 Å |
| c |
13.3584 ± 0.0008 Å |
| α |
90° |
| β |
107.211 ± 0.004° |
| γ |
90° |
| Cell volume |
1560.12 ± 0.16 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0361 |
| Residual factor for significantly intense reflections |
0.0285 |
| Weighted residual factors for significantly intense reflections |
0.0602 |
| Weighted residual factors for all reflections included in the refinement |
0.0624 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.148 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2219881.html