Information card for entry 2220096
| Chemical name |
4,4',6,6'-Tetrabromo-2,2'-(2,8-diazonia-5-azanona-1,8-diene-1,9-diyl)diphenolate |
| Formula |
C18 H17 Br4 N3 O2 |
| Calculated formula |
C18 H17 Br4 N3 O2 |
| SMILES |
BrC1=C/C(=C/NCCNCCN/C=C2/C=C(Br)C=C(C2=O)Br)C(=O)C(=C1)Br |
| Title of publication |
4,4',6,6'-Tetrabromo-2,2'-(2,8-diazonia-5-azanona-1,8-diene-1,9-diyl)diphenolate |
| Authors of publication |
Chen, Zhu-Jun; Lei, Ke-Wei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
12 |
| Pages of publication |
o2450 |
| a |
9.4506 ± 0.0011 Å |
| b |
9.1242 ± 0.0011 Å |
| c |
23.618 ± 0.003 Å |
| α |
90° |
| β |
94.774 ± 0.002° |
| γ |
90° |
| Cell volume |
2029.5 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0529 |
| Residual factor for significantly intense reflections |
0.0381 |
| Weighted residual factors for significantly intense reflections |
0.089 |
| Weighted residual factors for all reflections included in the refinement |
0.0954 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.048 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220096.html