Information card for entry 2220215
| Chemical name |
2-(4-Ferrocenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| Formula |
C22 H25 B Fe O2 |
| Calculated formula |
C22 H25 B Fe O2 |
| SMILES |
[Fe]12345678([cH]9[cH]8[cH]4[cH]5[cH]79)[cH]4[c]1(c1ccc(cc1)B1OC(C)(C(O1)(C)C)C)[cH]2[cH]6[cH]34 |
| Title of publication |
2-(4-Ferrocenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| Authors of publication |
Boyd, Peter D. W.; Paauwe, J. D. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
12 |
| Pages of publication |
m1494 |
| a |
12.4439 ± 0.0003 Å |
| b |
12.9832 ± 0.0003 Å |
| c |
13.0728 ± 0.0003 Å |
| α |
90° |
| β |
117.126 ± 0.001° |
| γ |
90° |
| Cell volume |
1879.75 ± 0.08 Å3 |
| Cell temperature |
89 ± 2 K |
| Ambient diffraction temperature |
89 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0346 |
| Residual factor for significantly intense reflections |
0.0311 |
| Weighted residual factors for significantly intense reflections |
0.0826 |
| Weighted residual factors for all reflections included in the refinement |
0.085 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220215.html