Information card for entry 2220231
| Chemical name |
3,4,5-Trimethoxybenzohydrazidium chloride |
| Formula |
C10 H15 Cl N2 O4 |
| Calculated formula |
C10 H15 Cl N2 O4 |
| SMILES |
[Cl-].O(c1cc(cc(OC)c1OC)C(=O)N[NH3+])C |
| Title of publication |
3,4,5-Trimethoxybenzohydrazidium chloride |
| Authors of publication |
Saeed, Aamer; Mumtaz, Amara; Rafique, Hummera; Gotoh, Kazuma; Ishida, Hiroyuki |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
12 |
| Pages of publication |
o2336 |
| a |
38.587 ± 0.003 Å |
| b |
4.8202 ± 0.0003 Å |
| c |
13.5915 ± 0.001 Å |
| α |
90° |
| β |
108.459 ± 0.002° |
| γ |
90° |
| Cell volume |
2397.9 ± 0.3 Å3 |
| Cell temperature |
223 ± 1 K |
| Ambient diffraction temperature |
223 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0461 |
| Residual factor for significantly intense reflections |
0.0396 |
| Weighted residual factors for significantly intense reflections |
0.1066 |
| Weighted residual factors for all reflections included in the refinement |
0.1112 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.058 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220231.html