Information card for entry 2220290
| Chemical name |
2,4-Bis[bis(diisopropylamino)phosphanyl]-1,2,3,4-\ tetraphosphabicyclo[1.1.0]butane |
| Formula |
C24 H56 N4 P6 |
| Calculated formula |
C24 H56 N4 P6 |
| SMILES |
C(C)(C)N(C(C)C)P(N(C(C)C)C(C)C)P1P2P(P(N(C(C)C)C(C)C)N(C(C)C)C(C)C)P12 |
| Title of publication |
2,4-Bis[bis(diisopropylamino)phosphanyl]-1,2,3,4-tetraphosphabicyclo[1.1.0]butane |
| Authors of publication |
Łapczuk-Krygier, Agnieszka; Baranowska, Katarzyna; Pikies, Jerzy |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
12 |
| Pages of publication |
o2427 |
| a |
13.3307 ± 0.0005 Å |
| b |
20.9304 ± 0.0007 Å |
| c |
12.8939 ± 0.0005 Å |
| α |
90° |
| β |
109.349 ± 0.004° |
| γ |
90° |
| Cell volume |
3394.4 ± 0.2 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0725 |
| Residual factor for significantly intense reflections |
0.0503 |
| Weighted residual factors for significantly intense reflections |
0.1244 |
| Weighted residual factors for all reflections included in the refinement |
0.1359 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220290.html