Information card for entry 2220322
| Chemical name |
Di-μ~2~-chlorido-bis[aqua(2,2'-bipyridine-4,4'-dicarboxylic acid-κ^2^<i>N</i>,<i>N</i>')(nitrato-κ<i>O</i>)copper(II)] |
| Formula |
C24 H20 Cl2 Cu2 N6 O16 |
| Calculated formula |
C24 H20 Cl2 Cu2 N6 O16 |
| SMILES |
c1cc(cc2c3cc(cc[n]3[Cu]3([n]12)(ON(=O)=O)([OH2])[Cl][Cu]1([n]2ccc(cc2c2cc(cc[n]12)C(=O)O)C(=O)O)([OH2])(ON(=O)=O)[Cl]3)C(=O)O)C(=O)O |
| Title of publication |
Di-μ~2~-chlorido-bis[aqua(2,2'-bipyridine-4,4'-dicarboxylic acid-κ^2^<i>N</i>,<i>N</i>')(nitrato-κ<i>O</i>)copper(II)] |
| Authors of publication |
Han, Ke-Fei; Wu, Hui-Yong; Wang, Zhong-Ming; Guo, Hong-You |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
12 |
| Pages of publication |
m1607 - m1608 |
| a |
6.95 ± 0.0007 Å |
| b |
8.149 ± 0.0007 Å |
| c |
13.548 ± 0.001 Å |
| α |
92.315 ± 0.002° |
| β |
103.384 ± 0.004° |
| γ |
98.556 ± 0.003° |
| Cell volume |
735.92 ± 0.11 Å3 |
| Cell temperature |
295 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.0352 |
| Weighted residual factors for all reflections included in the refinement |
0.1062 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.112 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220322.html