Information card for entry 2220367
| Chemical name |
2,2-Dimethyl-<i>N</i>,<i>N</i>'-bis(4-nitrobenzylidene)propane-1,3-diamine |
| Formula |
C19 H20 N4 O4 |
| Calculated formula |
C19 H20 N4 O4 |
| SMILES |
O=N(=O)c1ccc(cc1)/C=N/CC(C/N=C/c1ccc(N(=O)=O)cc1)(C)C |
| Title of publication |
2,2-Dimethyl-<i>N</i>,<i>N</i>'-bis(4-nitrobenzylidene)propane-1,3-diamine |
| Authors of publication |
Fun, Hoong-Kun; Kargar, Hadi; Kia, Reza |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2008 |
| Journal volume |
64 |
| Journal issue |
12 |
| Pages of publication |
o2335 |
| a |
7.8219 ± 0.0001 Å |
| b |
19.9716 ± 0.0004 Å |
| c |
12.0125 ± 0.0003 Å |
| α |
90° |
| β |
92.831 ± 0.001° |
| γ |
90° |
| Cell volume |
1874.25 ± 0.06 Å3 |
| Cell temperature |
100 ± 1 K |
| Ambient diffraction temperature |
100 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.101 |
| Residual factor for significantly intense reflections |
0.061 |
| Weighted residual factors for significantly intense reflections |
0.132 |
| Weighted residual factors for all reflections included in the refinement |
0.152 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220367.html