Information card for entry 2220418
| Chemical name |
<i>N</i>-(3-Bromo-1,4-dioxo-1,4-dihydro-2-naphthyl)-2-chloro-N-(2- chlorobenzoyl)benzamide |
| Formula |
C24 H12 Br Cl2 N O4 |
| Calculated formula |
C24 H12 Br Cl2 N O4 |
| SMILES |
Clc1ccccc1C(=O)N(C(=O)c1ccccc1Cl)C1=C(Br)C(=O)c2c(C1=O)cccc2 |
| Title of publication |
<i>N</i>-(3-Bromo-1,4-dioxo-1,4-dihydro-2-naphthyl)-2-chloro-<i>N</i>-(2-chlorobenzoyl)benzamide |
| Authors of publication |
Akinboye, Emmanuel S.; Butcher, Ray J.; Brandy, Yakini; Adesiyun, Tolulope A.; Bakare, Oladapo |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
1 |
| Pages of publication |
o24 |
| a |
12.859 ± 0.0003 Å |
| b |
7.8126 ± 0.0001 Å |
| c |
21.9574 ± 0.0004 Å |
| α |
90° |
| β |
106.272 ± 0.002° |
| γ |
90° |
| Cell volume |
2117.53 ± 0.07 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1026 |
| Residual factor for significantly intense reflections |
0.0466 |
| Weighted residual factors for significantly intense reflections |
0.114 |
| Weighted residual factors for all reflections included in the refinement |
0.1227 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.92 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220418.html