Information card for entry 2220492
| Chemical name |
2,2'-(<i>p</i>-Phenylenedimethylene)bis(propane-1,3-diol) |
| Formula |
C14 H22 O4 |
| Calculated formula |
C14 H22 O4 |
| SMILES |
OCC(Cc1ccc(cc1)CC(CO)CO)CO |
| Title of publication |
2,2'-(<i>p</i>-Phenylenedimethylene)bis(propane-1,3-diol) |
| Authors of publication |
Gao, Yajun; Xi, Haitao; Sun, Xiaoqiang; Fu, Yongsheng; Liu, Li |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
1 |
| Pages of publication |
o170 |
| a |
9.939 ± 0.006 Å |
| b |
8.803 ± 0.005 Å |
| c |
15.366 ± 0.009 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1344.4 ± 1.4 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0532 |
| Residual factor for significantly intense reflections |
0.0381 |
| Weighted residual factors for significantly intense reflections |
0.1064 |
| Weighted residual factors for all reflections included in the refinement |
0.1149 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.082 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220492.html