Information card for entry 2220770
| Chemical name |
2-({3-[(2<i>R</i>,4<i>S</i>,5<i>R</i>)-4-Hydroxy-5-hydroxymethyl-2,3,4,5- tetrahydrofuran-2-yl]-5-methyl-2,6-dioxo-1,2,3,6-tetrahydropyrimidin-1- yl}methyl)isoindoline-1,3-dione |
| Formula |
C19 H19 N3 O7 |
| Calculated formula |
C19 H19 N3 O7 |
| SMILES |
OC[C@H]1O[C@@H](N2C=C(C)C(=O)N(C2=O)CN2C(=O)c3ccccc3C2=O)C[C@@H]1O |
| Title of publication |
2-({3-[(2<i>R</i>,4<i>S</i>,5<i>R</i>)-4-Hydroxy-5-hydroxymethyl-2,3,4,5-tetrahydrofuran-2-yl]-5-methyl-2,6-dioxo-1,2,3,6-tetrahydropyrimidin-1-yl}methyl)isoindoline-1,3-dione |
| Authors of publication |
Bartholomä, Mark Daniel; Ouellette, Wayne; Zubieta, Jon |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
2 |
| Pages of publication |
o432 - o433 |
| a |
4.9334 ± 0.0004 Å |
| b |
11.6287 ± 0.0009 Å |
| c |
15.3208 ± 0.0012 Å |
| α |
90° |
| β |
91.43 ± 0.002° |
| γ |
90° |
| Cell volume |
878.67 ± 0.12 Å3 |
| Cell temperature |
90 ± 2 K |
| Ambient diffraction temperature |
90 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0506 |
| Residual factor for significantly intense reflections |
0.0446 |
| Weighted residual factors for significantly intense reflections |
0.0941 |
| Weighted residual factors for all reflections included in the refinement |
0.0971 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.076 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220770.html