Information card for entry 2220781
| Chemical name |
<i>cis</i>-Bis[<i>N</i>-(2-furoyl)-<i>N</i>',<i>N</i>'-diphenylthioureato- κ^2^<i>O</i>,<i>S</i>]nickel(II) |
| Formula |
C36 H26 N4 Ni O4 S2 |
| Calculated formula |
C36 H26 N4 Ni O4 S2 |
| SMILES |
[Ni]12([S]=C(N=C(O2)c2occc2)N(c2ccccc2)c2ccccc2)[S]=C(N=C(O1)c1occc1)N(c1ccccc1)c1ccccc1 |
| Title of publication |
<i>cis</i>-Bis[<i>N</i>-(2-furoyl)-<i>N</i>',<i>N</i>'-diphenylthioureato-κ^2^<i>O</i>,<i>S</i>]nickel(II) |
| Authors of publication |
Pérez, Hiram; Corrêa, Rodrigo S.; Plutín, Ana María; Calderón, Osmar; Duque, Julio |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
2 |
| Pages of publication |
m242 |
| a |
10.0458 ± 0.0002 Å |
| b |
11.003 ± 0.0003 Å |
| c |
15.9718 ± 0.0003 Å |
| α |
72.755 ± 0.002° |
| β |
88.792 ± 0.002° |
| γ |
74.874 ± 0.001° |
| Cell volume |
1624.61 ± 0.07 Å3 |
| Cell temperature |
294 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.064 |
| Weighted residual factors for all reflections included in the refinement |
0.1451 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.22 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220781.html