Information card for entry 2220906
| Chemical name |
4-(3-Methoxyphenyl)-3-[2-(4-methoxyphenyl)ethyl]-1<i>H</i>-1,2,4- triazol-5(4<i>H</i>)-one |
| Formula |
C18 H19 N3 O3 |
| Calculated formula |
C18 H19 N3 O3 |
| SMILES |
O=C1N(C(=NN1)CCc1ccc(OC)cc1)c1cc(OC)ccc1 |
| Title of publication |
4-(3-Methoxyphenyl)-3-[2-(4-methoxyphenyl)ethyl]-1<i>H</i>-1,2,4-triazol-5(4<i>H</i>)-one |
| Authors of publication |
Hanif, Muhammad; Qadeer, Ghulam; Rama, Nasim Hasan; Akhtar, Javeed; Helliwell, Madeleine |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
2 |
| Pages of publication |
o387 |
| a |
26.784 ± 0.004 Å |
| b |
14.824 ± 0.002 Å |
| c |
8.1108 ± 0.0011 Å |
| α |
90° |
| β |
96.522 ± 0.003° |
| γ |
90° |
| Cell volume |
3199.5 ± 0.8 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0772 |
| Residual factor for significantly intense reflections |
0.0448 |
| Weighted residual factors for significantly intense reflections |
0.0757 |
| Weighted residual factors for all reflections included in the refinement |
0.0833 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.929 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220906.html