Information card for entry 2220919
| Chemical name |
Chlorido[<i>N</i>'-(2-oxidobenzilidene)acetohydrazide- κ^2^<i>O</i>,<i>N</i>',<i>O</i>']copper(II) dihydrate |
| Formula |
C9 H13 Cl Cu N2 O4 |
| Calculated formula |
C9 H13 Cl Cu N2 O4 |
| SMILES |
[Cu]12([O]=C(N[N]2=Cc2c(O1)cccc2)C)Cl.O.O |
| Title of publication |
Chlorido[<i>N</i>'-(2-oxidobenzilidene)acetohydrazide-κ^2^<i>O</i>,<i>N</i>',<i>O</i>']copper(II) dihydrate |
| Authors of publication |
Tamboura, Farba Bouyagui; Gaye, Mohamed; Sall, Abdou Salam; Barry, Aliou Hamady; Bah, Youssouph |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
2 |
| Pages of publication |
m160 - m161 |
| a |
6.762 ± 0.002 Å |
| b |
8.987 ± 0.002 Å |
| c |
10.312 ± 0.003 Å |
| α |
76.94 ± 0.011° |
| β |
84.645 ± 0.012° |
| γ |
81.903 ± 0.013° |
| Cell volume |
603.1 ± 0.3 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0404 |
| Residual factor for significantly intense reflections |
0.0315 |
| Weighted residual factors for significantly intense reflections |
0.071 |
| Weighted residual factors for all reflections included in the refinement |
0.0749 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220919.html