Information card for entry 2220978
| Chemical name |
(2'-Amino-4,4'-bi-1,3-thiazol-2-aminium- κ^2^<i>N</i>,<i>N</i>')aqua[citrato(4-)- κ^3^<i>O</i>,<i>O</i>',<i>O</i>'')chromium(III) dihydrate |
| Formula |
C12 H17 Cr N4 O10 S2 |
| Calculated formula |
C12 H17 Cr N4 O10 S2 |
| SMILES |
[Cr]123([OH2])(OC(=O)CC(O2)(C(=O)O1)CC(=O)[O-])[n]1c(csc1N)c1[n]3c([NH3+])sc1.O.O |
| Title of publication |
(2'-Amino-4,4'-bi-1,3-thiazol-2-aminium-κ^2^<i>N</i>,<i>N</i>')aqua[citrato(4{-})-κ^3^<i>O</i>,<i>O</i>',<i>O</i>'')chromium(III) dihydrate |
| Authors of publication |
Liu, Bing-Xin; Du, Mei; Chen, Guang-Hua; Sun, Xiao-Yuan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
3 |
| Pages of publication |
m320 |
| a |
7.7438 ± 0.0015 Å |
| b |
11.193 ± 0.002 Å |
| c |
12.057 ± 0.002 Å |
| α |
72.35 ± 0.003° |
| β |
77.09 ± 0.002° |
| γ |
82.273 ± 0.003° |
| Cell volume |
968.2 ± 0.3 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0941 |
| Residual factor for significantly intense reflections |
0.06 |
| Weighted residual factors for significantly intense reflections |
0.144 |
| Weighted residual factors for all reflections included in the refinement |
0.1685 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.061 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220978.html