Information card for entry 2220999
| Chemical name |
3,5-Dimethyl-2,6-diphenyl-3,4,5,6-tetrahydro-2<i>H</i>-pyran-4-one |
| Formula |
C19 H20 O2 |
| Calculated formula |
C19 H20 O2 |
| SMILES |
O=C1[C@@H]([C@H](O[C@H]([C@@H]1C)c1ccccc1)c1ccccc1)C |
| Title of publication |
3,5-Dimethyl-2,6-diphenyl-3,4,5,6-tetrahydro-2<i>H</i>-pyran-4-one |
| Authors of publication |
Asghar, Muhammad Nadeem; Arshad, Muhammad Nadeem; Zia-ur-Rehman, Muhammad; Khan, Islam Ullah; Shafiq, Muhammad |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
3 |
| Pages of publication |
o463 |
| a |
14.7247 ± 0.001 Å |
| b |
9.2803 ± 0.0007 Å |
| c |
23.0393 ± 0.0016 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3148.3 ± 0.4 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.1714 |
| Residual factor for significantly intense reflections |
0.0495 |
| Weighted residual factors for significantly intense reflections |
0.1097 |
| Weighted residual factors for all reflections included in the refinement |
0.1627 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.924 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2220999.html