Information card for entry 2221220
| Chemical name |
2,5-Dimethyl-1-phenylsulfonyl-1<i>H</i>-pyrrole-3,4-dicarbaldehyde |
| Formula |
C14 H13 N O4 S |
| Calculated formula |
C14 H13 N O4 S |
| SMILES |
S(=O)(=O)(n1c(c(c(c1C)C=O)C=O)C)c1ccccc1 |
| Title of publication |
2,5-Dimethyl-1-phenylsulfonyl-1<i>H</i>-pyrrole-3,4-dicarbaldehyde |
| Authors of publication |
Seshadri, P. R.; Balakrishnan, B.; Ilangovan, K.; Sureshbabu, R.; Mohanakrishnan, A. K. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
3 |
| Pages of publication |
o531 |
| a |
9.0257 ± 0.0003 Å |
| b |
12.624 ± 0.0005 Å |
| c |
11.9914 ± 0.0005 Å |
| α |
90° |
| β |
97.7 ± 0.002° |
| γ |
90° |
| Cell volume |
1353.99 ± 0.09 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0749 |
| Residual factor for significantly intense reflections |
0.0482 |
| Weighted residual factors for significantly intense reflections |
0.1323 |
| Weighted residual factors for all reflections included in the refinement |
0.1537 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.003 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221220.html