Information card for entry 2221449
| Chemical name |
2-Amino-4-(4-bromophenyl)-8-trifluoromethyl-3,4- dihydropyrimido[1,2-<i>a</i>][1,3,5]triazin-6(5<i>H</i>)-one |
| Formula |
C13 H9 Br F3 N5 O |
| Calculated formula |
C13 H9 Br F3 N5 O |
| SMILES |
Brc1ccc(cc1)C1NC(=Nc2n1c(=O)cc(n2)C(F)(F)F)N |
| Title of publication |
2-Amino-4-(4-bromophenyl)-8-trifluoromethyl-3,4-dihydropyrimido[1,2-<i>a</i>][1,3,5]triazin-6(5<i>H</i>)-one |
| Authors of publication |
Dolzhenko, Anton V.; Sachdeva, Nikhil; Tan, Geok Kheng; Koh, Lip Lin; Chui, Wai Keung |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
4 |
| Pages of publication |
o684 |
| a |
10.0531 ± 0.0004 Å |
| b |
29.9108 ± 0.0013 Å |
| c |
10.1945 ± 0.0004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3065.4 ± 0.2 Å3 |
| Cell temperature |
223 ± 2 K |
| Ambient diffraction temperature |
223 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0679 |
| Residual factor for significantly intense reflections |
0.0517 |
| Weighted residual factors for significantly intense reflections |
0.129 |
| Weighted residual factors for all reflections included in the refinement |
0.1378 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221449.html