Information card for entry 2221555
| Chemical name |
(2,2'-Dimethyl-4,4'-bi-1,3-thiazole- κ^2^<i>N</i>,<i>N</i>')bis(thiocyanato-κ<i>S</i>)mercury(II) |
| Formula |
C10 H8 Hg N4 S4 |
| Calculated formula |
C10 H8 Hg N4 S4 |
| SMILES |
[Hg]1(SC#N)(SC#N)[n]2c(scc2c2[n]1c(sc2)C)C |
| Title of publication |
(2,2'-Dimethyl-4,4'-bi-1,3-thiazole-κ^2^<i>N</i>,<i>N</i>')bis(thiocyanato-κ<i>S</i>)mercury(II) |
| Authors of publication |
Safari, Nasser; Amani, Vahid; Abedi, Anita; Notash, Behrouz; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
4 |
| Pages of publication |
m372 |
| a |
17.3764 ± 0.0003 Å |
| b |
12.0534 ± 0.0002 Å |
| c |
7.0601 ± 0.0001 Å |
| α |
90° |
| β |
100.676 ± 0.001° |
| γ |
90° |
| Cell volume |
1453.1 ± 0.04 Å3 |
| Cell temperature |
118 ± 2 K |
| Ambient diffraction temperature |
118 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0266 |
| Residual factor for significantly intense reflections |
0.0219 |
| Weighted residual factors for significantly intense reflections |
0.0479 |
| Weighted residual factors for all reflections included in the refinement |
0.0535 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.041 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221555.html