Information card for entry 2221708
| Chemical name |
5,5'-Dimethoxy-2,2'-[(pentane-1,5-diyldioxy)bis(nitrilomethylidyne)]diphenol |
| Formula |
C21 H26 N2 O6 |
| Calculated formula |
C21 H26 N2 O6 |
| SMILES |
N(=C\c1c(O)cc(OC)cc1)/OCCCCCO/N=C/c1c(O)cc(OC)cc1 |
| Title of publication |
5,5'-Dimethoxy-2,2'-[(pentane-1,5-diyldioxy)bis(nitrilomethylidyne)]diphenol |
| Authors of publication |
Sun, Yin-Xia; Li, Li; Dong, Wen-Kui; Wu, Jian-Chao; Tong, Jun-Feng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
5 |
| Pages of publication |
o1160 |
| a |
7.3324 ± 0.0015 Å |
| b |
7.6214 ± 0.0017 Å |
| c |
20.372 ± 0.003 Å |
| α |
81.525 ± 0.001° |
| β |
89.928 ± 0.002° |
| γ |
67.87 ± 0.001° |
| Cell volume |
1041.2 ± 0.4 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1232 |
| Residual factor for significantly intense reflections |
0.0519 |
| Weighted residual factors for significantly intense reflections |
0.1082 |
| Weighted residual factors for all reflections included in the refinement |
0.1242 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.011 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221708.html