Information card for entry 2221864
| Chemical name |
4,4,5,5-Tetramethyl-2-(4-pyridinio)-2-imidazoline-1-oxyl-3-oxide perchlorate |
| Formula |
C12 H17 Cl N3 O6 |
| Calculated formula |
C12 H17 Cl N3 O6 |
| SMILES |
c1cc(C2=N(C(C)(C(C)(C)[N]2=O)C)=O)cc[nH+]1.[O-]Cl(=O)(=O)=O |
| Title of publication |
4,4,5,5-Tetramethyl-2-(4-pyridinio)-2-imidazoline-1-oxyl-3-oxide perchlorate |
| Authors of publication |
Gao, Zhi-Yong; Chang, Jiu-Li; Xian, Dong; Jiang, Kai |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
5 |
| Pages of publication |
o1062 |
| a |
17.485 ± 0.004 Å |
| b |
11.854 ± 0.002 Å |
| c |
14.921 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3092.6 ± 1 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
43 |
| Hermann-Mauguin space group symbol |
F d d 2 |
| Hall space group symbol |
F 2 -2d |
| Residual factor for all reflections |
0.0338 |
| Residual factor for significantly intense reflections |
0.0331 |
| Weighted residual factors for significantly intense reflections |
0.1014 |
| Weighted residual factors for all reflections included in the refinement |
0.1023 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.059 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2221864.html