Information card for entry 2222034
| Chemical name |
6-(1-Adamantyl)-3-(2-fluorophenyl)-1,2,4- triazolo[3,4-<i>b</i>][1,3,4]thiadiazole |
| Formula |
C19 H19 F N4 S |
| Calculated formula |
C19 H19 F N4 S |
| SMILES |
s1c2nnc(n2nc1C12CC3CC(C1)CC(C2)C3)c1c(F)cccc1 |
| Title of publication |
6-(1-Adamantyl)-3-(2-fluorophenyl)-1,2,4-triazolo[3,4-<i>b</i>][1,3,4]thiadiazole |
| Authors of publication |
Khan, Mahmood-ul-Hassan; Hameed, Shahid; Tahir, M. Nawaz; Bokhari, Tanveer Hussain; Khan, Islam Ullah |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
6 |
| Pages of publication |
o1437 |
| a |
13.2684 ± 0.0009 Å |
| b |
12.4293 ± 0.0009 Å |
| c |
20.2231 ± 0.0015 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3335.1 ± 0.4 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0746 |
| Residual factor for significantly intense reflections |
0.0468 |
| Weighted residual factors for significantly intense reflections |
0.1168 |
| Weighted residual factors for all reflections included in the refinement |
0.1361 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.036 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222034.html