Information card for entry 2222243
| Chemical name |
1-(2-Methylimidazo[1,2-<i>a</i>]pyridin-3-yl)-3,3-bis(methylsulfanyl)prop- 2-enone monohydrate |
| Formula |
C13 H16 N2 O2 S2 |
| Calculated formula |
C13 H16 N2 O2 S2 |
| SMILES |
S(/C(=C\C(=O)c1n2ccccc2nc1C)SC)C.O |
| Title of publication |
1-(2-Methylimidazo[1,2-<i>a</i>]pyridin-3-yl)-3,3-bis(methylsulfanyl)prop-2-enone monohydrate |
| Authors of publication |
Bibila Mayaya Bisseyou, Yvon; Sissouma, Drissa; Goulizan Bi, Severin D.; Ouattara, Mahama; Yao-Kakou, R. C. A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
7 |
| Pages of publication |
o1698 - o1699 |
| a |
5.1405 ± 0.0001 Å |
| b |
17.7653 ± 0.0003 Å |
| c |
31.3919 ± 0.0006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2866.79 ± 0.09 Å3 |
| Cell temperature |
295 K |
| Ambient diffraction temperature |
295 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0988 |
| Residual factor for significantly intense reflections |
0.0467 |
| Weighted residual factors for all reflections |
0.1375 |
| Weighted residual factors for significantly intense reflections |
0.1049 |
| Weighted residual factors for all reflections included in the refinement |
0.0973 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.9899 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222243.html