Information card for entry 2222539
| Chemical name |
<i>N</i>^2^,<i>N</i>^2^,<i>N</i>^4^,<i>N</i>^4^-Tetraethyl-6-{2-[(<i>E</i>)- 1-(4-nitrophenyl)ethylidene]hydrazino}-1,3,5-triazine-2,4-diamine |
| Formula |
C19 H28 N8 O2 |
| Calculated formula |
C19 H28 N8 O2 |
| SMILES |
n1c(N/N=C(/c2ccc(N(=O)=O)cc2)C)nc(nc1N(CC)CC)N(CC)CC |
| Title of publication |
<i>N</i>^2^,<i>N</i>^2^,<i>N</i>^4^,<i>N</i>^4^-Tetraethyl-6-{2-[(<i>E</i>)-1-(4-nitrophenyl)ethylidene]hydrazino}-1,3,5-triazine-2,4-diamine |
| Authors of publication |
Pan, Xiao-Ru; Jian, Fang-Fang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
8 |
| Pages of publication |
o1844 |
| a |
12.333 ± 0.003 Å |
| b |
9.5286 ± 0.0019 Å |
| c |
17.407 ± 0.004 Å |
| α |
90° |
| β |
92.12 ± 0.03° |
| γ |
90° |
| Cell volume |
2044.2 ± 0.8 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0416 |
| Residual factor for significantly intense reflections |
0.0361 |
| Weighted residual factors for significantly intense reflections |
0.1003 |
| Weighted residual factors for all reflections included in the refinement |
0.1036 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222539.html