Information card for entry 2222546
| Chemical name |
Butane-1,2,3,4-tetracarboxylic acid–4,4'-bipyridine (1/2) |
| Formula |
C28 H26 N4 O8 |
| Calculated formula |
C28 H26 N4 O8 |
| SMILES |
n1ccc(cc1)c1ccncc1.n1ccc(cc1)c1ccncc1.OC(=O)[C@H]([C@H](C(=O)O)CC(=O)O)CC(=O)O |
| Title of publication |
Butane-1,2,3,4-tetracarboxylic acid–4,4'-bipyridine (1/2) |
| Authors of publication |
Zhang, Ning; Shi, Xue-Min; Shao, Min; Li, Ming-Xing |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
8 |
| Pages of publication |
o2016 |
| a |
7.4435 ± 0.0011 Å |
| b |
8.699 ± 0.0013 Å |
| c |
11.438 ± 0.002 Å |
| α |
99.819 ± 0.003° |
| β |
105.662 ± 0.003° |
| γ |
111.361 ± 0.002° |
| Cell volume |
633.58 ± 0.17 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.076 |
| Residual factor for significantly intense reflections |
0.0606 |
| Weighted residual factors for significantly intense reflections |
0.1622 |
| Weighted residual factors for all reflections included in the refinement |
0.1762 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.073 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222546.html