Information card for entry 2222559
| Chemical name |
4,4'-Di-<i>tert</i>-butyl-2,2'-bipyridine |
| Formula |
C18 H24 N2 |
| Calculated formula |
C18 H24 N2 |
| SMILES |
n1ccc(cc1c1nccc(c1)C(C)(C)C)C(C)(C)C |
| Title of publication |
4,4'-Di-<i>tert</i>-butyl-2,2'-bipyridine |
| Authors of publication |
Amarante, Tatiana R.; Figueiredo, Sónia; Lopes, André D.; Gonçalves, Isabel S.; Almeida Paz, Filipe A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
8 |
| Pages of publication |
o2047 |
| a |
10.241 ± 0.005 Å |
| b |
6.228 ± 0.003 Å |
| c |
24.559 ± 0.01 Å |
| α |
90° |
| β |
99.75 ± 0.03° |
| γ |
90° |
| Cell volume |
1543.8 ± 1.2 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1185 |
| Residual factor for significantly intense reflections |
0.0798 |
| Weighted residual factors for significantly intense reflections |
0.1937 |
| Weighted residual factors for all reflections included in the refinement |
0.2165 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.124 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222559.html