Information card for entry 2222583
| Chemical name |
Methyl 1,2,3,4,4a,5,5a,13c-octahydro-5-phenyl-6<i>H</i>- benz[<i>f</i>]chromeno[3,4-<i>b</i>]indolizine-5a-carboxylate |
| Formula |
C27 H27 N O3 |
| Calculated formula |
C27 H27 N O3 |
| SMILES |
C1CCC[C@H]2[C@H]([C@@]3([C@@H](c4c5ccccc5ccc4OC3)N12)C(=O)OC)c1ccccc1.C1CCC[C@@H]2[C@@H]([C@]3([C@H](c4c5ccccc5ccc4OC3)N12)C(=O)OC)c1ccccc1 |
| Title of publication |
Methyl 5-phenyl-1,2,3,4,4a,5,5a,13c-octahydro-6<i>H</i>-benzo[<i>f</i>]chromeno[3,4-<i>b</i>]indolizine-5a-carboxylate |
| Authors of publication |
Kamala, E. Theboral Sugi; Nirmala, S.; Sudha, L.; Kathiravan, S.; Raghunathan, R. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
8 |
| Pages of publication |
o1923 - o1924 |
| a |
9.4201 ± 0.0003 Å |
| b |
10.6752 ± 0.0003 Å |
| c |
11.0761 ± 0.0003 Å |
| α |
78.262 ± 0.002° |
| β |
77.911 ± 0.002° |
| γ |
87.346 ± 0.002° |
| Cell volume |
1066.34 ± 0.05 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0624 |
| Residual factor for significantly intense reflections |
0.0435 |
| Weighted residual factors for significantly intense reflections |
0.1089 |
| Weighted residual factors for all reflections included in the refinement |
0.1222 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.995 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222583.html