Information card for entry 2222853
| Chemical name |
<i>N</i>^3^,<i>N</i>^6^,2,5,7-pentaphenyl-2,5,7-triazabicyclo[2.2.1]heptane- 3,6-diamine |
| Formula |
C34 H31 N5 |
| Calculated formula |
C34 H31 N5 |
| SMILES |
[C@H]12N([C@H]([C@H](N([C@H]1Nc1ccccc1)c1ccccc1)N2c1ccccc1)Nc1ccccc1)c1ccccc1 |
| Title of publication |
<i>N</i>^3^,<i>N</i>^6^,2,5,7-Pentaphenyl-2,5,7-triazabicyclo[2.2.1]heptane-3,6-diamine |
| Authors of publication |
Taheri, Amir; Moosavi, Sayed Mojtaba |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
8 |
| Pages of publication |
o1724 |
| a |
9.7427 ± 0.0004 Å |
| b |
16.4049 ± 0.0007 Å |
| c |
17.0658 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2727.6 ± 0.2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0378 |
| Residual factor for significantly intense reflections |
0.031 |
| Weighted residual factors for significantly intense reflections |
0.0686 |
| Weighted residual factors for all reflections included in the refinement |
0.0721 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.007 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222853.html