Information card for entry 2222996
| Chemical name |
<i>N</i>,<i>N</i>'-Bis(2,3-dimethoxybenzylidene)propane-1,3-diamine |
| Formula |
C21 H26 N2 O4 |
| Calculated formula |
C21 H26 N2 O4 |
| SMILES |
O(c1c(cccc1OC)/C=N/CCC/N=C/c1c(OC)c(OC)ccc1)C |
| Title of publication |
<i>N</i>,<i>N</i>'-Bis(2,3-dimethoxybenzylidene)propane-1,3-diamine |
| Authors of publication |
Fejfarová, Karla; Dehno Khalaji, Aliakbar; Dušek, Michal |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
9 |
| Pages of publication |
o2288 |
| a |
15.3079 ± 0.0003 Å |
| b |
9.2915 ± 0.0002 Å |
| c |
13.8059 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1963.66 ± 0.07 Å3 |
| Cell temperature |
120 K |
| Ambient diffraction temperature |
120 K |
| Number of distinct elements |
4 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0248 |
| Residual factor for significantly intense reflections |
0.0248 |
| Weighted residual factors for significantly intense reflections |
0.0767 |
| Weighted residual factors for all reflections included in the refinement |
0.0767 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.97 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2222996.html