Information card for entry 2223080
| Chemical name |
(1<i>E</i>,4<i>E</i>)-1,5-Bis(2,4-dimethylphenyl)penta-1,4-dien-3-one |
| Formula |
C21 H22 O |
| Calculated formula |
C21 H22 O |
| SMILES |
O=C(/C=C/c1ccc(cc1C)C)/C=C/c1c(cc(cc1)C)C |
| Title of publication |
(1<i>E</i>,4<i>E</i>)-1,5-Bis(2,4-dimethylphenyl)penta-1,4-dien-3-one |
| Authors of publication |
Feng, Zhiguo; Li, Junhua; Lin, Yi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
9 |
| Pages of publication |
o2275 |
| a |
4.9548 ± 0.0007 Å |
| b |
26.555 ± 0.004 Å |
| c |
12.9632 ± 0.0019 Å |
| α |
90° |
| β |
94.09 ± 0.003° |
| γ |
90° |
| Cell volume |
1701.3 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0906 |
| Residual factor for significantly intense reflections |
0.0645 |
| Weighted residual factors for significantly intense reflections |
0.1595 |
| Weighted residual factors for all reflections included in the refinement |
0.173 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.965 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223080.html