Information card for entry 2223131
| Common name |
3-(2-Chloroethyl)-2-methyl-4<i>H</i>-pyrido[1,2-<i>a</i>] pyrimidinium-4-one picrate |
| Chemical name |
3-(2-Chloroethyl)-2-methyl-4-oxo-4<i>H</i>-pyrido[1,2-<i>a</i>]pyrimidinium 2,4,6-trinitrophenolate |
| Formula |
C17 H14 Cl N5 O8 |
| Calculated formula |
C17 H14 Cl N5 O8 |
| SMILES |
ClCCc1c(=O)n2c([nH+]c1C)cccc2.[O-]c1c(cc(N(=O)=O)cc1N(=O)=O)N(=O)=O |
| Title of publication |
3-(2-Chloroethyl)-2-methyl-4-oxo-4<i>H</i>-pyrido[1,2-<i>a</i>]pyrimidinium 2,4,6-trinitrophenolate |
| Authors of publication |
Jasinski, Jerry P.; Butcher, Ray J.; Hakim Al-Arique, Q. N. M.; Yathirajan, H. S.; Narayana, B. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
9 |
| Pages of publication |
o2201 - o2202 |
| a |
7.2718 ± 0.0005 Å |
| b |
12.8159 ± 0.0009 Å |
| c |
19.94 ± 0.003 Å |
| α |
90° |
| β |
97.642 ± 0.009° |
| γ |
90° |
| Cell volume |
1841.8 ± 0.3 Å3 |
| Cell temperature |
110 ± 2 K |
| Ambient diffraction temperature |
110 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0399 |
| Residual factor for significantly intense reflections |
0.035 |
| Weighted residual factors for significantly intense reflections |
0.0943 |
| Weighted residual factors for all reflections included in the refinement |
0.0974 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.034 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223131.html