Information card for entry 2223253
| Chemical name |
2,2-Dimethyl-5-[(3-nitroanilino)methylene]-1,3-dioxane-4,6-dione |
| Formula |
C13 H12 N2 O6 |
| Calculated formula |
C13 H12 N2 O6 |
| SMILES |
O1C(=O)C(=CNc2cc(N(=O)=O)ccc2)C(=O)OC1(C)C |
| Title of publication |
2,2-Dimethyl-5-[(3-nitroanilino)methylene]-1,3-dioxane-4,6-dione |
| Authors of publication |
Zhou, Meng; Li, Rui; Ding, Zhen-Yu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
9 |
| Pages of publication |
o2171 |
| a |
11.79 ± 0.0013 Å |
| b |
8.7699 ± 0.0009 Å |
| c |
14.0614 ± 0.0015 Å |
| α |
90° |
| β |
113.864 ± 0.001° |
| γ |
90° |
| Cell volume |
1329.6 ± 0.2 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.043 |
| Residual factor for significantly intense reflections |
0.036 |
| Weighted residual factors for significantly intense reflections |
0.095 |
| Weighted residual factors for all reflections included in the refinement |
0.101 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.05 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223253.html