Information card for entry 2223257
| Chemical name |
<i>N</i>,<i>N</i>'-Bis(1-acetylcyclohexyl)-1,8:4,5-naphthalenetetracarboximide |
| Formula |
C30 H30 N2 O6 |
| Calculated formula |
C30 H30 N2 O6 |
| SMILES |
CC(=O)C1(CCCCC1)N1C(=O)c2ccc3c4c2c(C1=O)ccc4C(=O)N(C3=O)C1(CCCCC1)C(=O)C |
| Title of publication |
<i>N</i>,<i>N</i>'-Bis(1-acetylcyclohexyl)-1,8:4,5-naphthalenetetracarboximide |
| Authors of publication |
Gondo, Chenaimwoyo A.; Lynch, Daniel E.; Hamilton, Darren G. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
9 |
| Pages of publication |
o2184 |
| a |
5.8553 ± 0.0002 Å |
| b |
13.6603 ± 0.0006 Å |
| c |
15.282 ± 0.0006 Å |
| α |
90° |
| β |
94.001 ± 0.002° |
| γ |
90° |
| Cell volume |
1219.35 ± 0.08 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0755 |
| Residual factor for significantly intense reflections |
0.063 |
| Weighted residual factors for significantly intense reflections |
0.1418 |
| Weighted residual factors for all reflections included in the refinement |
0.15 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.168 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223257.html