Information card for entry 2223476
| Common name |
[(2<i>S</i>,3<i>R</i>,4<i>R</i>,5<i>R</i>)-3,4-dihydroxy-5- (hydroxymethyl)proline] |
| Chemical name |
(2<i>S</i>,3<i>R</i>,4<i>R</i>,5<i>R</i>)-3,4-Dihydroxy-5- (hydroxymethyl)pyrrolidine-2-carboxylic acid |
| Formula |
C6 H11 N O5 |
| Calculated formula |
C6 H11 N O5 |
| SMILES |
O=C([O-])[C@H]1[NH2+][C@H](CO)[C@H]([C@@H]1O)O |
| Title of publication |
(2<i>S</i>,3<i>R</i>,4<i>R</i>,5<i>R</i>)-3,4-Dihydroxy-5-(hydroxymethyl)pyrrolidine-2-carboxylic acid [(2<i>S</i>,3<i>R</i>,4<i>R</i>,5<i>R</i>)-3,4-dihydroxy-5-(hydroxymethyl)proline] |
| Authors of publication |
Best, Daniel; Jenkinson, Sarah F.; Thompson, Amber L.; Watkin, David J.; Wilson, Francis X.; Nash, Robert J.; Fleet, George W. J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
10 |
| Pages of publication |
o2418 - o2419 |
| a |
5.416 ± 0.0002 Å |
| b |
5.8236 ± 0.0003 Å |
| c |
6.6006 ± 0.0003 Å |
| α |
102.836 ± 0.002° |
| β |
104.776 ± 0.002° |
| γ |
102.824 ± 0.0019° |
| Cell volume |
187.504 ± 0.015 Å3 |
| Cell temperature |
150 K |
| Ambient diffraction temperature |
150 K |
| Number of distinct elements |
4 |
| Space group number |
1 |
| Hermann-Mauguin space group symbol |
P 1 |
| Hall space group symbol |
P 1 |
| Residual factor for all reflections |
0.029 |
| Residual factor for significantly intense reflections |
0.0274 |
| Weighted residual factors for all reflections |
0.066 |
| Weighted residual factors for significantly intense reflections |
0.0644 |
| Weighted residual factors for all reflections included in the refinement |
0.066 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2223476.html